C23H19N3O4S — CID 135772941
(2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-(2-hydroxyphenyl)methylidenehydrazinylidene]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135772941) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is (2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-(2-hydroxyphenyl)methylidenehydrazinylidene]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-(2-hydroxyphenyl)methylidenehydrazinylidene]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135772941 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | (2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-(2-hydroxyphenyl)methylidenehydrazinylidene]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2\S/C(=N/N=C\c3ccccc3O)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C23H19N3O4S/c1-29-18-10-8-16(9-11-18)13-21-22(28)26(15-19-6-4-12-30-19)23(31-21)25-24-14-17-5-2-3-7-20(17)27/h2-14,27H,15H2,1H3/b21-13-,24-14-,25-23+ |
| InChIKey | DXMWZBJOGLDEOZ-TZOGYSKPSA-N |
| XLogP | 4.50 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|