C20H15N3O3S2 — CID 135732450
(2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-(2-hydroxyphenyl)methylidenehydrazinylidene]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 135732450) has the molecular formula C20H15N3O3S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is (2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-(2-hydroxyphenyl)methylidenehydrazinylidene]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-(2-hydroxyphenyl)methylidenehydrazinylidene]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135732450 |
| Molecular Formula | C20H15N3O3S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | (2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-(2-hydroxyphenyl)methylidenehydrazinylidene]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccs2)S/C(=N\N=C\c2ccccc2O)N1Cc1ccco1 |
| InChI | InChI=1S/C20H15N3O3S2/c24-17-8-2-1-5-14(17)12-21-22-20-23(13-15-6-3-9-26-15)19(25)18(28-20)11-16-7-4-10-27-16/h1-12,24H,13H2/b18-11-,21-12+,22-20- |
| InChIKey | GAIZIUTYSRPTED-GZFVJNORSA-N |
| XLogP | 4.55 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|