C20H14ClN3O2S2 — CID 16627798
(2Z,5Z)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 16627798) has the molecular formula C20H14ClN3O2S2 and a molecular weight of 427.94 g/mol. Its IUPAC name is (2Z,5Z)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16627798 |
| Molecular Formula | C20H14ClN3O2S2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | (2Z,5Z)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccs2)S/C(=N\N=C\c2ccc(Cl)cc2)N1Cc1ccco1 |
| InChI | InChI=1S/C20H14ClN3O2S2/c21-15-7-5-14(6-8-15)12-22-23-20-24(13-16-3-1-9-26-16)19(25)18(28-20)11-17-4-2-10-27-17/h1-12H,13H2/b18-11-,22-12+,23-20- |
| InChIKey | RPMGJBOJZVEQRM-XSQCUTPVSA-N |
| XLogP | 5.50 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|