C22H16N4O5S — CID 19246999
(2E,5Z)-3-(furan-2-ylmethyl)-5-[(2-hydroxyphenyl)methylidene]-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 19246999) has the molecular formula C22H16N4O5S and a molecular weight of 448.46 g/mol. Its IUPAC name is (2E,5Z)-3-(furan-2-ylmethyl)-5-[(2-hydroxyphenyl)methylidene]-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-(furan-2-ylmethyl)-5-[(2-hydroxyphenyl)methylidene]-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19246999 |
| Molecular Formula | C22H16N4O5S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | (2E,5Z)-3-(furan-2-ylmethyl)-5-[(2-hydroxyphenyl)methylidene]-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccccc2O)S/C(=N/N=C\c2ccc([N+](=O)[O-])cc2)N1Cc1ccco1 |
| InChI | InChI=1S/C22H16N4O5S/c27-19-6-2-1-4-16(19)12-20-21(28)25(14-18-5-3-11-31-18)22(32-20)24-23-13-15-7-9-17(10-8-15)26(29)30/h1-13,27H,14H2/b20-12-,23-13-,24-22+ |
| InChIKey | YNGCKHFCENZSJM-ZUYYYZHBSA-N |
| XLogP | 4.40 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|