C22H16N4O4S — CID 16627475
(2Z,5Z)-2-[(E)-benzylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 16627475) has the molecular formula C22H16N4O4S and a molecular weight of 432.46 g/mol. Its IUPAC name is (2Z,5Z)-2-[(E)-benzylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-[(E)-benzylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16627475 |
| Molecular Formula | C22H16N4O4S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | (2Z,5Z)-2-[(E)-benzylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc([N+](=O)[O-])cc2)S/C(=N\N=C\c2ccccc2)N1Cc1ccco1 |
| InChI | InChI=1S/C22H16N4O4S/c27-21-20(13-16-8-10-18(11-9-16)26(28)29)31-22(25(21)15-19-7-4-12-30-19)24-23-14-17-5-2-1-3-6-17/h1-14H,15H2/b20-13-,23-14+,24-22- |
| InChIKey | HDTNWDSDIPFFPN-BEBFMXFYSA-N |
| XLogP | 4.69 |
| TPSA | 101.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|