C27H27N3O3S — CID 16627706
(2Z,5Z)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 16627706) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is (2Z,5Z)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16627706 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (2Z,5Z)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2\S/C(=N\N=C\c3ccc(C(C)(C)C)cc3)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C27H27N3O3S/c1-27(2,3)21-11-7-20(8-12-21)17-28-29-26-30(18-23-6-5-15-33-23)25(31)24(34-26)16-19-9-13-22(32-4)14-10-19/h5-17H,18H2,1-4H3/b24-16-,28-17+,29-26- |
| InChIKey | FVBUXEZEXRSINH-VPHHVEAJSA-N |
| XLogP | 6.09 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|