C26H23Cl2N3O2S — CID 16628098
(2Z,5Z)-5-[(4-tert-butylphenyl)methylidene]-2-[(E)-(2,3-dichlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 16628098) has the molecular formula C26H23Cl2N3O2S and a molecular weight of 512.46 g/mol. Its IUPAC name is (2Z,5Z)-5-[(4-tert-butylphenyl)methylidene]-2-[(E)-(2,3-dichlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-5-[(4-tert-butylphenyl)methylidene]-2-[(E)-(2,3-dichlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16628098 |
| Molecular Formula | C26H23Cl2N3O2S |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | (2Z,5Z)-5-[(4-tert-butylphenyl)methylidene]-2-[(E)-(2,3-dichlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1ccc(/C=C2\S/C(=N\N=C\c3cccc(Cl)c3Cl)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C26H23Cl2N3O2S/c1-26(2,3)19-11-9-17(10-12-19)14-22-24(32)31(16-20-7-5-13-33-20)25(34-22)30-29-15-18-6-4-8-21(27)23(18)28/h4-15H,16H2,1-3H3/b22-14-,29-15+,30-25- |
| InChIKey | GSFNUTIFDUYVDO-KRKGYHJXSA-N |
| XLogP | 7.39 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|