C24H19Cl2N3O5S — CID 135772996
(2E,5Z)-5-[(2,3-dichlorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135772996) has the molecular formula C24H19Cl2N3O5S and a molecular weight of 532.41 g/mol. Its IUPAC name is (2E,5Z)-5-[(2,3-dichlorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(2,3-dichlorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135772996 |
| Molecular Formula | C24H19Cl2N3O5S |
| Molecular Weight | 532.41 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | (2E,5Z)-5-[(2,3-dichlorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=N\N=C2\S/C(=C\c3cccc(Cl)c3Cl)C(=O)N2Cc2ccco2)cc(OC)c1O |
| InChI | InChI=1S/C24H19Cl2N3O5S/c1-32-18-9-14(10-19(33-2)22(18)30)12-27-28-24-29(13-16-6-4-8-34-16)23(31)20(35-24)11-15-5-3-7-17(25)21(15)26/h3-12,30H,13H2,1-2H3/b20-11-,27-12-,28-24+ |
| InChIKey | CSKMYVUGMLPZCE-HOAHKQQZSA-N |
| XLogP | 5.82 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|