C30H25N3O6S — CID 16628016
(2Z,5Z)-3-(furan-2-ylmethyl)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-[(E)-(3-phenoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 16628016) has the molecular formula C30H25N3O6S and a molecular weight of 555.61 g/mol. Its IUPAC name is (2Z,5Z)-3-(furan-2-ylmethyl)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-[(E)-(3-phenoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-3-(furan-2-ylmethyl)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-[(E)-(3-phenoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16628016 |
| Molecular Formula | C30H25N3O6S |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | (2Z,5Z)-3-(furan-2-ylmethyl)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-[(E)-(3-phenoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N\N=C\c3cccc(Oc4ccccc4)c3)N(Cc3ccco3)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C30H25N3O6S/c1-36-25-15-21(16-26(37-2)28(25)34)17-27-29(35)33(19-24-12-7-13-38-24)30(40-27)32-31-18-20-8-6-11-23(14-20)39-22-9-4-3-5-10-22/h3-18,34H,19H2,1-2H3/b27-17-,31-18+,32-30- |
| InChIKey | PIHSPKHRNYRJTG-LOMIDIPPSA-N |
| XLogP | 6.30 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|