C27H24ClN3O4S — CID 137129004
2-[2-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 137129004) has the molecular formula C27H24ClN3O4S and a molecular weight of 522.03 g/mol. Its IUPAC name is 2-[2-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 137129004 |
| Molecular Formula | C27H24ClN3O4S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 2-[2-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cccc(/C=C2/S/C(=N\c3cccc(Cl)c3C)NC2=O)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C27H24ClN3O4S/c1-16-10-12-19(13-11-16)29-24(32)15-35-25-18(6-4-9-22(25)34-3)14-23-26(33)31-27(36-23)30-21-8-5-7-20(28)17(21)2/h4-14H,15H2,1-3H3,(H,29,32)(H,30,31,33)/b23-14+ |
| InChIKey | PQIGTBAIPUNIBF-OEAKJJBVSA-N |
| XLogP | 5.87 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|