C26H22IN3O4S — CID 137074258
2-[2-iodo-6-methoxy-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 137074258) has the molecular formula C26H22IN3O4S and a molecular weight of 599.45 g/mol. Its IUPAC name is 2-[2-iodo-6-methoxy-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-iodo-6-methoxy-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 137074258 |
| Molecular Formula | C26H22IN3O4S |
| Molecular Weight | 599.45 g/mol |
| Exact Mass | 599.04 |
| IUPAC Name | 2-[2-iodo-6-methoxy-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccccc3)NC2=O)cc(I)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C26H22IN3O4S/c1-16-7-6-10-19(11-16)28-23(31)15-34-24-20(27)12-17(13-21(24)33-2)14-22-25(32)30-26(35-22)29-18-8-4-3-5-9-18/h3-14H,15H2,1-2H3,(H,28,31)(H,29,30,32)/b22-14- |
| InChIKey | JYVOFUIBSBHOHL-HMAPJEAMSA-N |
| XLogP | 5.52 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|