C29H28IN3O5S — CID 137139297
2-[2-ethoxy-4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 137139297) has the molecular formula C29H28IN3O5S and a molecular weight of 657.53 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 137139297 |
| Molecular Formula | C29H28IN3O5S |
| Molecular Weight | 657.53 g/mol |
| Exact Mass | 657.08 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1ccc(/N=C2/NC(=O)/C(=C\c3cc(I)c(OCC(=O)Nc4ccc(C)cc4)c(OCC)c3)S2)cc1 |
| InChI | InChI=1S/C29H28IN3O5S/c1-4-36-22-12-10-21(11-13-22)32-29-33-28(35)25(39-29)16-19-14-23(30)27(24(15-19)37-5-2)38-17-26(34)31-20-8-6-18(3)7-9-20/h6-16H,4-5,17H2,1-3H3,(H,31,34)(H,32,33,35)/b25-16+ |
| InChIKey | JYLNXWUOCXLJDH-PCLIKHOPSA-N |
| XLogP | 6.31 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|