C25H20BrN3O3S — CID 137063871
N-(4-bromophenyl)-2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 137063871) has the molecular formula C25H20BrN3O3S and a molecular weight of 522.42 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 137063871 |
| Molecular Formula | C25H20BrN3O3S |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | N-(4-bromophenyl)-2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3ccc(OCC(=O)Nc4ccc(Br)cc4)cc3)S2)cc1 |
| InChI | InChI=1S/C25H20BrN3O3S/c1-16-2-8-20(9-3-16)28-25-29-24(31)22(33-25)14-17-4-12-21(13-5-17)32-15-23(30)27-19-10-6-18(26)7-11-19/h2-14H,15H2,1H3,(H,27,30)(H,28,29,31)/b22-14- |
| InChIKey | GDPXZVLLBNVDQM-HMAPJEAMSA-N |
| XLogP | 5.67 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|