C25H19ClIN3O4S — CID 137073753
2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-phenylacetamide (PubChem CID 137073753) has the molecular formula C25H19ClIN3O4S and a molecular weight of 619.87 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 137073753 |
| Molecular Formula | C25H19ClIN3O4S |
| Molecular Weight | 619.87 g/mol |
| Exact Mass | 618.98 |
| IUPAC Name | 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-phenylacetamide |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(Cl)cc3)NC2=O)cc(I)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H19ClIN3O4S/c1-33-20-12-15(11-19(27)23(20)34-14-22(31)28-17-5-3-2-4-6-17)13-21-24(32)30-25(35-21)29-18-9-7-16(26)8-10-18/h2-13H,14H2,1H3,(H,28,31)(H,29,30,32)/b21-13- |
| InChIKey | CNKHRGAWOJWDCF-BKUYFWCQSA-N |
| XLogP | 5.86 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.87 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|