C18H11ClI2N2O4S — CID 137107732
2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetic acid (PubChem CID 137107732) has the molecular formula C18H11ClI2N2O4S and a molecular weight of 640.62 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetic acid |
|---|---|
| PubChem CID | 137107732 |
| Molecular Formula | C18H11ClI2N2O4S |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 639.82 |
| IUPAC Name | 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetic acid |
| SMILES | O=C(O)COc1c(I)cc(/C=C2\S/C(=N/c3ccc(Cl)cc3)NC2=O)cc1I |
| InChI | InChI=1S/C18H11ClI2N2O4S/c19-10-1-3-11(4-2-10)22-18-23-17(26)14(28-18)7-9-5-12(20)16(13(21)6-9)27-8-15(24)25/h1-7H,8H2,(H,24,25)(H,22,23,26)/b14-7- |
| InChIKey | GXOXPVNMSFRXII-AUWJEWJLSA-N |
| XLogP | 4.90 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|