C22H19ClN2O5S — CID 137118316
2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]acetic acid (PubChem CID 137118316) has the molecular formula C22H19ClN2O5S and a molecular weight of 458.92 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]acetic acid |
|---|---|
| PubChem CID | 137118316 |
| Molecular Formula | C22H19ClN2O5S |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]acetic acid |
| SMILES | C=CCc1cc(/C=C2\S/C(=N/c3ccc(Cl)cc3)NC2=O)cc(OC)c1OCC(=O)O |
| InChI | InChI=1S/C22H19ClN2O5S/c1-3-4-14-9-13(10-17(29-2)20(14)30-12-19(26)27)11-18-21(28)25-22(31-18)24-16-7-5-15(23)6-8-16/h3,5-11H,1,4,12H2,2H3,(H,26,27)(H,24,25,28)/b18-11- |
| InChIKey | CSFXRDAEOARHMT-WQRHYEAKSA-N |
| XLogP | 4.43 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|