C30H30N2O3S — CID 137021425
(5Z)-2-(4-ethylphenyl)imino-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137021425) has the molecular formula C30H30N2O3S and a molecular weight of 498.65 g/mol. Its IUPAC name is (5Z)-2-(4-ethylphenyl)imino-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-ethylphenyl)imino-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137021425 |
| Molecular Formula | C30H30N2O3S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | (5Z)-2-(4-ethylphenyl)imino-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(/C=C2\S/C(=N/c3ccc(CC)cc3)NC2=O)cc(OC)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C30H30N2O3S/c1-5-7-24-16-23(17-26(34-4)28(24)35-19-22-10-8-20(3)9-11-22)18-27-29(33)32-30(36-27)31-25-14-12-21(6-2)13-15-25/h5,8-18H,1,6-7,19H2,2-4H3,(H,31,32,33)/b27-18- |
| InChIKey | HUFUHILSSSAVGC-IMRQLAEWSA-N |
| XLogP | 6.77 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|