C19H13FI2N2O2S — CID 135641299
(5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135641299) has the molecular formula C19H13FI2N2O2S and a molecular weight of 606.20 g/mol. Its IUPAC name is (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135641299 |
| Molecular Formula | C19H13FI2N2O2S |
| Molecular Weight | 606.20 g/mol |
| Exact Mass | 605.88 |
| IUPAC Name | (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1c(I)cc(/C=C2/S/C(=N\c3ccc(F)cc3)NC2=O)cc1I |
| InChI | InChI=1S/C19H13FI2N2O2S/c1-2-7-26-17-14(21)8-11(9-15(17)22)10-16-18(25)24-19(27-16)23-13-5-3-12(20)4-6-13/h2-6,8-10H,1,7H2,(H,23,24,25)/b16-10+ |
| InChIKey | GXGIBTUDKGMLSS-MHWRWJLKSA-N |
| XLogP | 5.49 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.20 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|