C19H12Cl2I2N2O2S — CID 136715861
(5Z)-2-(2,3-dichlorophenyl)imino-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 136715861) has the molecular formula C19H12Cl2I2N2O2S and a molecular weight of 657.10 g/mol. Its IUPAC name is (5Z)-2-(2,3-dichlorophenyl)imino-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2,3-dichlorophenyl)imino-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136715861 |
| Molecular Formula | C19H12Cl2I2N2O2S |
| Molecular Weight | 657.10 g/mol |
| Exact Mass | 655.81 |
| IUPAC Name | (5Z)-2-(2,3-dichlorophenyl)imino-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1c(I)cc(/C=C2\S/C(=N/c3cccc(Cl)c3Cl)NC2=O)cc1I |
| InChI | InChI=1S/C19H12Cl2I2N2O2S/c1-2-6-27-17-12(22)7-10(8-13(17)23)9-15-18(26)25-19(28-15)24-14-5-3-4-11(20)16(14)21/h2-5,7-9H,1,6H2,(H,24,25,26)/b15-9- |
| InChIKey | FKXAGVYAVDIRFS-DHDCSXOGSA-N |
| XLogP | 6.66 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.10 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|