C16H8Cl4N2O2S — CID 135527532
5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135527532) has the molecular formula C16H8Cl4N2O2S and a molecular weight of 434.13 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135527532 |
| Molecular Formula | C16H8Cl4N2O2S |
| Molecular Weight | 434.13 g/mol |
| Exact Mass | 431.91 |
| IUPAC Name | 5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2cccc(Cl)c2Cl)SC1=Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C16H8Cl4N2O2S/c17-8-2-1-3-11(13(8)20)21-16-22-15(24)12(25-16)6-7-4-9(18)14(23)10(19)5-7/h1-6,23H,(H,21,22,24) |
| InChIKey | XKUXCMKWFVKEJA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.13 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|