C16H9Cl2N3O3S — CID 135426164
(5Z)-2-(2,3-dichlorophenyl)imino-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135426164) has the molecular formula C16H9Cl2N3O3S and a molecular weight of 394.24 g/mol. Its IUPAC name is (5Z)-2-(2,3-dichlorophenyl)imino-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2,3-dichlorophenyl)imino-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135426164 |
| Molecular Formula | C16H9Cl2N3O3S |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | (5Z)-2-(2,3-dichlorophenyl)imino-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2cccc(Cl)c2Cl)S/C1=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H9Cl2N3O3S/c17-11-5-2-6-12(14(11)18)19-16-20-15(22)13(25-16)8-9-3-1-4-10(7-9)21(23)24/h1-8H,(H,19,20,22)/b13-8- |
| InChIKey | RIYOHMVPMMRTBD-JYRVWZFOSA-N |
| XLogP | 4.79 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|