C16H11N3O4S — CID 135555405
(5E)-2-(3-hydroxyphenyl)imino-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135555405) has the molecular formula C16H11N3O4S and a molecular weight of 341.35 g/mol. Its IUPAC name is (5E)-2-(3-hydroxyphenyl)imino-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(3-hydroxyphenyl)imino-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135555405 |
| Molecular Formula | C16H11N3O4S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (5E)-2-(3-hydroxyphenyl)imino-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2cccc(O)c2)S/C1=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11N3O4S/c20-13-6-2-4-11(9-13)17-16-18-15(21)14(24-16)8-10-3-1-5-12(7-10)19(22)23/h1-9,20H,(H,17,18,21)/b14-8+ |
| InChIKey | AQGJOQSLPDCUSR-RIYZIHGNSA-N |
| XLogP | 3.19 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|