C17H13N3O5S2 — CID 171982869
(NE)-4-methyl-N-[(5E)-5-[(3-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 171982869) has the molecular formula C17H13N3O5S2 and a molecular weight of 403.44 g/mol. Its IUPAC name is (NE)-4-methyl-N-[(5E)-5-[(3-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | (NE)-4-methyl-N-[(5E)-5-[(3-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 171982869 |
| Molecular Formula | C17H13N3O5S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | (NE)-4-methyl-N-[(5E)-5-[(3-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2\NC(=O)/C(=C\c3cccc([N+](=O)[O-])c3)S2)cc1 |
| InChI | InChI=1S/C17H13N3O5S2/c1-11-5-7-14(8-6-11)27(24,25)19-17-18-16(21)15(26-17)10-12-3-2-4-13(9-12)20(22)23/h2-10H,1H3,(H,18,19,21)/b15-10+ |
| InChIKey | LGHNYKDXHQVFTF-XNTDXEJSSA-N |
| XLogP | 2.85 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|