C23H17N3O6S2 — CID 137020679
[3-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzenesulfonate (PubChem CID 137020679) has the molecular formula C23H17N3O6S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is [3-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [3-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 137020679 |
| Molecular Formula | C23H17N3O6S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | [3-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzenesulfonate |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3cccc(OS(=O)(=O)c4cccc([N+](=O)[O-])c4)c3)S2)cc1 |
| InChI | InChI=1S/C23H17N3O6S2/c1-15-8-10-17(11-9-15)24-23-25-22(27)21(33-23)13-16-4-2-6-19(12-16)32-34(30,31)20-7-3-5-18(14-20)26(28)29/h2-14H,1H3,(H,24,25,27)/b21-13- |
| InChIKey | KSRUVESYTADTMR-BKUYFWCQSA-N |
| XLogP | 4.56 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|