C24H18BrN3O7S2 — CID 137043979
[2-bromo-6-methoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzenesulfonate (PubChem CID 137043979) has the molecular formula C24H18BrN3O7S2 and a molecular weight of 604.46 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [2-bromo-6-methoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 137043979 |
| Molecular Formula | C24H18BrN3O7S2 |
| Molecular Weight | 604.46 g/mol |
| Exact Mass | 602.98 |
| IUPAC Name | [2-bromo-6-methoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzenesulfonate |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(C)cc3)NC2=O)cc(Br)c1OS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18BrN3O7S2/c1-14-6-8-16(9-7-14)26-24-27-23(29)21(36-24)12-15-10-19(25)22(20(11-15)34-2)35-37(32,33)18-5-3-4-17(13-18)28(30)31/h3-13H,1-2H3,(H,26,27,29)/b21-12- |
| InChIKey | JQWPXKDHTHDABW-MTJSOVHGSA-N |
| XLogP | 5.33 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|