C24H17IN4O9S2 — CID 137063803
[2-iodo-6-methoxy-4-[(E)-[2-(2-methyl-4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate (PubChem CID 137063803) has the molecular formula C24H17IN4O9S2 and a molecular weight of 696.46 g/mol. Its IUPAC name is [2-iodo-6-methoxy-4-[(E)-[2-(2-methyl-4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate.
| Compound Name | [2-iodo-6-methoxy-4-[(E)-[2-(2-methyl-4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 137063803 |
| Molecular Formula | C24H17IN4O9S2 |
| Molecular Weight | 696.46 g/mol |
| Exact Mass | 695.95 |
| IUPAC Name | [2-iodo-6-methoxy-4-[(E)-[2-(2-methyl-4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate |
| SMILES | COc1cc(/C=C2/S/C(=N\c3ccc([N+](=O)[O-])cc3C)NC2=O)cc(I)c1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H17IN4O9S2/c1-13-9-16(29(33)34)5-8-19(13)26-24-27-23(30)21(39-24)12-14-10-18(25)22(20(11-14)37-2)38-40(35,36)17-6-3-15(4-7-17)28(31)32/h3-12H,1-2H3,(H,26,27,30)/b21-12+ |
| InChIKey | MOZGPJDZCUZXDX-CIAFOILYSA-N |
| XLogP | 5.08 |
| TPSA | 180.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|