C24H17BrIN3O7S2 — CID 137063054
[4-[(E)-[2-(2-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenyl] 4-nitrobenzenesulfonate (PubChem CID 137063054) has the molecular formula C24H17BrIN3O7S2 and a molecular weight of 730.36 g/mol. Its IUPAC name is [4-[(E)-[2-(2-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenyl] 4-nitrobenzenesulfonate.
| Compound Name | [4-[(E)-[2-(2-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 137063054 |
| Molecular Formula | C24H17BrIN3O7S2 |
| Molecular Weight | 730.36 g/mol |
| Exact Mass | 728.87 |
| IUPAC Name | [4-[(E)-[2-(2-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenyl] 4-nitrobenzenesulfonate |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccccc3Br)NC2=O)cc(I)c1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H17BrIN3O7S2/c1-2-35-20-12-14(13-21-23(30)28-24(37-21)27-19-6-4-3-5-17(19)25)11-18(26)22(20)36-38(33,34)16-9-7-15(8-10-16)29(31)32/h3-13H,2H2,1H3,(H,27,28,30)/b21-13+ |
| InChIKey | LOKYLLRHMNVSMQ-FYJGNVAPSA-N |
| XLogP | 6.02 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.36 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|