C25H21IN2O5S2 — CID 137063253
[2-ethoxy-4-[(E)-[2-(2-iodophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 137063253) has the molecular formula C25H21IN2O5S2 and a molecular weight of 620.49 g/mol. Its IUPAC name is [2-ethoxy-4-[(E)-[2-(2-iodophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-ethoxy-4-[(E)-[2-(2-iodophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 137063253 |
| Molecular Formula | C25H21IN2O5S2 |
| Molecular Weight | 620.49 g/mol |
| Exact Mass | 619.99 |
| IUPAC Name | [2-ethoxy-4-[(E)-[2-(2-iodophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccccc3I)NC2=O)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H21IN2O5S2/c1-3-32-22-14-17(10-13-21(22)33-35(30,31)18-11-8-16(2)9-12-18)15-23-24(29)28-25(34-23)27-20-7-5-4-6-19(20)26/h4-15H,3H2,1-2H3,(H,27,28,29)/b23-15+ |
| InChIKey | VFBWSANMQKUEFZ-HZHRSRAPSA-N |
| XLogP | 5.66 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|