C23H18N2O5S2 — CID 137060780
[2-methoxy-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate (PubChem CID 137060780) has the molecular formula C23H18N2O5S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate.
| Compound Name | [2-methoxy-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 137060780 |
| Molecular Formula | C23H18N2O5S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | [2-methoxy-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccccc3)NC2=O)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H18N2O5S2/c1-29-20-14-16(12-13-19(20)30-32(27,28)18-10-6-3-7-11-18)15-21-22(26)25-23(31-21)24-17-8-4-2-5-9-17/h2-15H,1H3,(H,24,25,26)/b21-15- |
| InChIKey | KDFWAZGACBESIE-QNGOZBTKSA-N |
| XLogP | 4.35 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|