C23H16ClN3O7S2 — CID 137118949
[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate (PubChem CID 137118949) has the molecular formula C23H16ClN3O7S2 and a molecular weight of 545.98 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate.
| Compound Name | [4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 137118949 |
| Molecular Formula | C23H16ClN3O7S2 |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 545.01 |
| IUPAC Name | [4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(Cl)cc3)NC2=O)ccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H16ClN3O7S2/c1-33-19-12-14(13-20-22(28)26-23(35-20)25-16-9-7-15(24)8-10-16)6-11-18(19)34-36(31,32)21-5-3-2-4-17(21)27(29)30/h2-13H,1H3,(H,25,26,28)/b20-13- |
| InChIKey | MTAYMUSWCSVXQV-MOSHPQCFSA-N |
| XLogP | 4.92 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|