C22H13Cl3N2O4S2 — CID 137074784
[2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 137074784) has the molecular formula C22H13Cl3N2O4S2 and a molecular weight of 539.85 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 137074784 |
| Molecular Formula | C22H13Cl3N2O4S2 |
| Molecular Weight | 539.85 g/mol |
| Exact Mass | 537.94 |
| IUPAC Name | [2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2)S/C1=C\c1ccc(OS(=O)(=O)c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C22H13Cl3N2O4S2/c23-14-2-6-16(7-3-14)26-22-27-21(28)20(32-22)12-13-1-10-19(18(25)11-13)31-33(29,30)17-8-4-15(24)5-9-17/h1-12H,(H,26,27,28)/b20-12- |
| InChIKey | QZIQESXTJLCOJG-NDENLUEZSA-N |
| XLogP | 6.31 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.85 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|