C23H16BrClN2O4S2 — CID 137062835
[2-bromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 137062835) has the molecular formula C23H16BrClN2O4S2 and a molecular weight of 563.88 g/mol. Its IUPAC name is [2-bromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-bromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 137062835 |
| Molecular Formula | C23H16BrClN2O4S2 |
| Molecular Weight | 563.88 g/mol |
| Exact Mass | 561.94 |
| IUPAC Name | [2-bromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=C3/S/C(=N\c4ccc(Cl)cc4)NC3=O)cc2Br)cc1 |
| InChI | InChI=1S/C23H16BrClN2O4S2/c1-14-2-9-18(10-3-14)33(29,30)31-20-11-4-15(12-19(20)24)13-21-22(28)27-23(32-21)26-17-7-5-16(25)6-8-17/h2-13H,1H3,(H,26,27,28)/b21-13+ |
| InChIKey | CTNUVEMEBPXAAY-FYJGNVAPSA-N |
| XLogP | 6.07 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.88 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|