C16H9BrClNO4S3 — CID 2929837
[2-bromo-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 2929837) has the molecular formula C16H9BrClNO4S3 and a molecular weight of 490.81 g/mol. Its IUPAC name is [2-bromo-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-bromo-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 2929837 |
| Molecular Formula | C16H9BrClNO4S3 |
| Molecular Weight | 490.81 g/mol |
| Exact Mass | 488.86 |
| IUPAC Name | [2-bromo-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=C1NC(=S)SC1=Cc1ccc(OS(=O)(=O)c2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C16H9BrClNO4S3/c17-12-7-9(8-14-15(20)19-16(24)25-14)1-6-13(12)23-26(21,22)11-4-2-10(18)3-5-11/h1-8H,(H,19,20,24) |
| InChIKey | KAGWAHOQQDEMTB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|