C17H13ClN2O5S2 — CID 154792528
[5-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 154792528) has the molecular formula C17H13ClN2O5S2 and a molecular weight of 424.89 g/mol. Its IUPAC name is [5-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [5-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 154792528 |
| Molecular Formula | C17H13ClN2O5S2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | [5-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2ccc(OC)c(OS(=O)(=O)c3ccc(Cl)cc3)c2)S1 |
| InChI | InChI=1S/C17H13ClN2O5S2/c1-24-13-7-2-10(9-15-16(21)20-17(19)26-15)8-14(13)25-27(22,23)12-5-3-11(18)4-6-12/h2-9H,1H3,(H2,19,20,21)/b15-9- |
| InChIKey | OVMKEBMYBMRBRA-DHDCSXOGSA-N |
| XLogP | 3.25 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|