C11H9ClN2O4S2 — CID 171129134
[2-chloro-4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] methanesulfonate (PubChem CID 171129134) has the molecular formula C11H9ClN2O4S2 and a molecular weight of 332.79 g/mol. Its IUPAC name is [2-chloro-4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] methanesulfonate.
| Compound Name | [2-chloro-4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 171129134 |
| Molecular Formula | C11H9ClN2O4S2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | [2-chloro-4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] methanesulfonate |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2ccc(OS(C)(=O)=O)c(Cl)c2)S1 |
| InChI | InChI=1S/C11H9ClN2O4S2/c1-20(16,17)18-8-3-2-6(4-7(8)12)5-9-10(15)14-11(13)19-9/h2-5H,1H3,(H2,13,14,15) |
| InChIKey | NZPNZSWVRZUJEO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|