C10H8N2O4S2 — CID 171127983
4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzenesulfonic acid (PubChem CID 171127983) has the molecular formula C10H8N2O4S2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzenesulfonic acid.
| Compound Name | 4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 171127983 |
| Molecular Formula | C10H8N2O4S2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzenesulfonic acid |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2ccc(S(=O)(=O)O)cc2)S1 |
| InChI | InChI=1S/C10H8N2O4S2/c11-10-12-9(13)8(17-10)5-6-1-3-7(4-2-6)18(14,15)16/h1-5H,(H2,11,12,13)(H,14,15,16) |
| InChIKey | ZLUHEBXAPALZMT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|