C13H9N3OS — CID 168510639
(5E)-2-imino-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 168510639) has the molecular formula C13H9N3OS and a molecular weight of 255.30 g/mol. Its IUPAC name is (5E)-2-imino-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-imino-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168510639 |
| Molecular Formula | C13H9N3OS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | (5E)-2-imino-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)/C(=C\c2ccc3ncccc3c2)S1 |
| InChI | InChI=1S/C13H9N3OS/c14-13-16-12(17)11(18-13)7-8-3-4-10-9(6-8)2-1-5-15-10/h1-7H,(H2,14,16,17)/b11-7+ |
| InChIKey | GWSGFSPSQGXVFI-YRNVUSSQSA-N |
| XLogP | 2.37 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|