C18H11ClN4OS — CID 136659589
2-[(2-chloro-3-pyridinyl)imino]-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 136659589) has the molecular formula C18H11ClN4OS and a molecular weight of 366.83 g/mol. Its IUPAC name is 2-[(2-chloro-3-pyridinyl)imino]-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | 2-[(2-chloro-3-pyridinyl)imino]-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136659589 |
| Molecular Formula | C18H11ClN4OS |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-[(2-chloro-3-pyridinyl)imino]-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2cccnc2Cl)SC1=Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C18H11ClN4OS/c19-16-14(4-2-8-21-16)22-18-23-17(24)15(25-18)10-11-5-6-13-12(9-11)3-1-7-20-13/h1-10H,(H,22,23,24) |
| InChIKey | LWMVKFAKSJATPY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|