C26H17ClN4O2S — CID 136654761
N-[3-chloro-4-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]benzamide (PubChem CID 136654761) has the molecular formula C26H17ClN4O2S and a molecular weight of 484.97 g/mol. Its IUPAC name is N-[3-chloro-4-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]benzamide.
| Compound Name | N-[3-chloro-4-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 136654761 |
| Molecular Formula | C26H17ClN4O2S |
| Molecular Weight | 484.97 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | N-[3-chloro-4-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]benzamide |
| SMILES | O=C1N/C(=N/c2ccc(NC(=O)c3ccccc3)cc2Cl)SC1=Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C26H17ClN4O2S/c27-20-15-19(29-24(32)17-5-2-1-3-6-17)9-11-22(20)30-26-31-25(33)23(34-26)14-16-8-10-21-18(13-16)7-4-12-28-21/h1-15H,(H,29,32)(H,30,31,33) |
| InChIKey | DMKAFSMTCZYQAN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.97 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|