C25H23ClN6O2S — CID 136626174
N-[4-chloro-3-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]-2-piperazin-1-ylacetamide (PubChem CID 136626174) has the molecular formula C25H23ClN6O2S and a molecular weight of 507.02 g/mol. Its IUPAC name is N-[4-chloro-3-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]-2-piperazin-1-ylacetamide.
| Compound Name | N-[4-chloro-3-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 136626174 |
| Molecular Formula | C25H23ClN6O2S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | N-[4-chloro-3-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]-2-piperazin-1-ylacetamide |
| SMILES | O=C(CN1CCNCC1)Nc1ccc(Cl)c(/N=C2/NC(=O)C(=Cc3ccc4ncccc4c3)S2)c1 |
| InChI | InChI=1S/C25H23ClN6O2S/c26-19-5-4-18(29-23(33)15-32-10-8-27-9-11-32)14-21(19)30-25-31-24(34)22(35-25)13-16-3-6-20-17(12-16)2-1-7-28-20/h1-7,12-14,27H,8-11,15H2,(H,29,33)(H,30,31,34) |
| InChIKey | ADBMUVBZDSNXPO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|