C24H19ClN4O3S — CID 135428904
(5E)-2-[2-chloro-5-[(3S)-3-hydroxypyrrolidine-1-carbonyl]phenyl]imino-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 135428904) has the molecular formula C24H19ClN4O3S and a molecular weight of 478.96 g/mol. Its IUPAC name is (5E)-2-[2-chloro-5-[(3S)-3-hydroxypyrrolidine-1-carbonyl]phenyl]imino-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-[2-chloro-5-[(3S)-3-hydroxypyrrolidine-1-carbonyl]phenyl]imino-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135428904 |
| Molecular Formula | C24H19ClN4O3S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | (5E)-2-[2-chloro-5-[(3S)-3-hydroxypyrrolidine-1-carbonyl]phenyl]imino-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2cc(C(=O)N3CC[C@H](O)C3)ccc2Cl)S/C1=C/c1ccc2ncccc2c1 |
| InChI | InChI=1S/C24H19ClN4O3S/c25-18-5-4-16(23(32)29-9-7-17(30)13-29)12-20(18)27-24-28-22(31)21(33-24)11-14-3-6-19-15(10-14)2-1-8-26-19/h1-6,8,10-12,17,30H,7,9,13H2,(H,27,28,31)/b21-11+/t17-/m0/s1 |
| InChIKey | AXZJDUFHPNDKIK-RYFGYPJOSA-N |
| XLogP | 3.99 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|