C25H22ClN5O3S — CID 136659537
N-[4-chloro-3-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]-2-morpholin-4-ylacetamide (PubChem CID 136659537) has the molecular formula C25H22ClN5O3S and a molecular weight of 508.00 g/mol. Its IUPAC name is N-[4-chloro-3-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[4-chloro-3-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 136659537 |
| Molecular Formula | C25H22ClN5O3S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | N-[4-chloro-3-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)Nc1ccc(Cl)c(/N=C2/NC(=O)C(=Cc3ccc4ncccc4c3)S2)c1 |
| InChI | InChI=1S/C25H22ClN5O3S/c26-19-5-4-18(28-23(32)15-31-8-10-34-11-9-31)14-21(19)29-25-30-24(33)22(35-25)13-16-3-6-20-17(12-16)2-1-7-27-20/h1-7,12-14H,8-11,15H2,(H,28,32)(H,29,30,33) |
| InChIKey | JJQCWBHZYDCCHS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|