C27H25ClN6O3S — CID 136594567
N-[4-chloro-3-[[5-[(3-morpholin-4-ylquinoxalin-6-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]cyclobutanecarboxamide (PubChem CID 136594567) has the molecular formula C27H25ClN6O3S and a molecular weight of 549.06 g/mol. Its IUPAC name is N-[4-chloro-3-[[5-[(3-morpholin-4-ylquinoxalin-6-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[4-chloro-3-[[5-[(3-morpholin-4-ylquinoxalin-6-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 136594567 |
| Molecular Formula | C27H25ClN6O3S |
| Molecular Weight | 549.06 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | N-[4-chloro-3-[[5-[(3-morpholin-4-ylquinoxalin-6-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]cyclobutanecarboxamide |
| SMILES | O=C1N/C(=N/c2cc(NC(=O)C3CCC3)ccc2Cl)SC1=Cc1ccc2ncc(N3CCOCC3)nc2c1 |
| InChI | InChI=1S/C27H25ClN6O3S/c28-19-6-5-18(30-25(35)17-2-1-3-17)14-21(19)32-27-33-26(36)23(38-27)13-16-4-7-20-22(12-16)31-24(15-29-20)34-8-10-37-11-9-34/h4-7,12-15,17H,1-3,8-11H2,(H,30,35)(H,32,33,36) |
| InChIKey | KZNFFDQGXVCWQX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.06 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|