C20H16ClN5O3S2 — CID 136652412
N-[4-chloro-3-[[4-oxo-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]ethanesulfonamide (PubChem CID 136652412) has the molecular formula C20H16ClN5O3S2 and a molecular weight of 473.97 g/mol. Its IUPAC name is N-[4-chloro-3-[[4-oxo-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]ethanesulfonamide.
| Compound Name | N-[4-chloro-3-[[4-oxo-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 136652412 |
| Molecular Formula | C20H16ClN5O3S2 |
| Molecular Weight | 473.97 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | N-[4-chloro-3-[[4-oxo-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Cl)c(/N=C2/NC(=O)C(=Cc3ccc4nccnc4c3)S2)c1 |
| InChI | InChI=1S/C20H16ClN5O3S2/c1-2-31(28,29)26-13-4-5-14(21)16(11-13)24-20-25-19(27)18(30-20)10-12-3-6-15-17(9-12)23-8-7-22-15/h3-11,26H,2H2,1H3,(H,24,25,27) |
| InChIKey | HKSGOGIPQZICRL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.97 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|