C25H15ClN4O2S — CID 136651665
2-(3-benzoyl-2-chlorophenyl)imino-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 136651665) has the molecular formula C25H15ClN4O2S and a molecular weight of 470.94 g/mol. Its IUPAC name is 2-(3-benzoyl-2-chlorophenyl)imino-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-benzoyl-2-chlorophenyl)imino-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136651665 |
| Molecular Formula | C25H15ClN4O2S |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 2-(3-benzoyl-2-chlorophenyl)imino-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2cccc(C(=O)c3ccccc3)c2Cl)SC1=Cc1ccc2nccnc2c1 |
| InChI | InChI=1S/C25H15ClN4O2S/c26-22-17(23(31)16-5-2-1-3-6-16)7-4-8-19(22)29-25-30-24(32)21(33-25)14-15-9-10-18-20(13-15)28-12-11-27-18/h1-14H,(H,29,30,32) |
| InChIKey | BZNKEHQTFRRNEU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|