C18H11Cl2N4NaOS — CID 173098108
sodium;2-(2,6-dichlorophenyl)imino-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one;hydride (PubChem CID 173098108) has the molecular formula C18H11Cl2N4NaOS and a molecular weight of 425.28 g/mol. Its IUPAC name is sodium;2-(2,6-dichlorophenyl)imino-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one;hydride.
| Compound Name | sodium;2-(2,6-dichlorophenyl)imino-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one;hydride |
|---|---|
| PubChem CID | 173098108 |
| Molecular Formula | C18H11Cl2N4NaOS |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | sodium;2-(2,6-dichlorophenyl)imino-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one;hydride |
| SMILES | O=C1N/C(=N/c2c(Cl)cccc2Cl)SC1=Cc1ccc2nccnc2c1.[H-].[Na+] |
| InChI | InChI=1S/C18H10Cl2N4OS.Na.H/c19-11-2-1-3-12(20)16(11)23-18-24-17(25)15(26-18)9-10-4-5-13-14(8-10)22-7-6-21-13;;/h1-9H,(H,23,24,25);;/q;+1;-1 |
| InChIKey | XUPJDUZBSICTPQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|