C25H15Cl2N3OS — CID 136628070
2-(2,6-dichlorophenyl)imino-5-[(4-phenylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 136628070) has the molecular formula C25H15Cl2N3OS and a molecular weight of 476.39 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)imino-5-[(4-phenylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(2,6-dichlorophenyl)imino-5-[(4-phenylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136628070 |
| Molecular Formula | C25H15Cl2N3OS |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 2-(2,6-dichlorophenyl)imino-5-[(4-phenylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2c(Cl)cccc2Cl)SC1=Cc1ccc2nccc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C25H15Cl2N3OS/c26-19-7-4-8-20(27)23(19)29-25-30-24(31)22(32-25)14-15-9-10-21-18(13-15)17(11-12-28-21)16-5-2-1-3-6-16/h1-14H,(H,29,30,31) |
| InChIKey | BWRWFUMEHQLSPQ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|