C22H14Cl3N3O3S — CID 136642235
ethyl 4-chloro-6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylate (PubChem CID 136642235) has the molecular formula C22H14Cl3N3O3S and a molecular weight of 506.80 g/mol. Its IUPAC name is ethyl 4-chloro-6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylate.
| Compound Name | ethyl 4-chloro-6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 136642235 |
| Molecular Formula | C22H14Cl3N3O3S |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 504.98 |
| IUPAC Name | ethyl 4-chloro-6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(C=C3S/C(=N\c4c(Cl)cccc4Cl)NC3=O)cc2c1Cl |
| InChI | InChI=1S/C22H14Cl3N3O3S/c1-2-31-21(30)13-10-26-16-7-6-11(8-12(16)18(13)25)9-17-20(29)28-22(32-17)27-19-14(23)4-3-5-15(19)24/h3-10H,2H2,1H3,(H,27,28,29) |
| InChIKey | KDZIKWYCGADDHN-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|