C27H18Cl2N4O3S — CID 173085863
6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethyl-4-pyridin-4-ylquinoline-3-carboxylic acid (PubChem CID 173085863) has the molecular formula C27H18Cl2N4O3S and a molecular weight of 549.44 g/mol. Its IUPAC name is 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethyl-4-pyridin-4-ylquinoline-3-carboxylic acid.
| Compound Name | 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethyl-4-pyridin-4-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 173085863 |
| Molecular Formula | C27H18Cl2N4O3S |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethyl-4-pyridin-4-ylquinoline-3-carboxylic acid |
| SMILES | CCc1nc2ccc(C=C3S/C(=N\c4c(Cl)cccc4Cl)NC3=O)cc2c(-c2ccncc2)c1C(=O)O |
| InChI | InChI=1S/C27H18Cl2N4O3S/c1-2-19-23(26(35)36)22(15-8-10-30-11-9-15)16-12-14(6-7-20(16)31-19)13-21-25(34)33-27(37-21)32-24-17(28)4-3-5-18(24)29/h3-13H,2H2,1H3,(H,35,36)(H,32,33,34) |
| InChIKey | IAMDPQGCDGFGAD-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|