C18H9Cl2N5O3S — CID 136648427
6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,2,4-benzotriazine-3-carboxylic acid (PubChem CID 136648427) has the molecular formula C18H9Cl2N5O3S and a molecular weight of 446.28 g/mol. Its IUPAC name is 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,2,4-benzotriazine-3-carboxylic acid.
| Compound Name | 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,2,4-benzotriazine-3-carboxylic acid |
|---|---|
| PubChem CID | 136648427 |
| Molecular Formula | C18H9Cl2N5O3S |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,2,4-benzotriazine-3-carboxylic acid |
| SMILES | O=C1N/C(=N/c2c(Cl)cccc2Cl)SC1=Cc1ccc2nnc(C(=O)O)nc2c1 |
| InChI | InChI=1S/C18H9Cl2N5O3S/c19-9-2-1-3-10(20)14(9)22-18-23-16(26)13(29-18)7-8-4-5-11-12(6-8)21-15(17(27)28)25-24-11/h1-7H,(H,27,28)(H,22,23,26) |
| InChIKey | SKWRKYQJSCWSEL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|